C16H19ClN2O6 — CID 59365398
3-(4-chlorophenyl)-4-[[(1-ethoxy-1-oxopropan-2-ylidene)amino]oxycarbonylamino]butanoic acid (PubChem CID 59365398) has the molecular formula C16H19ClN2O6 and a molecular weight of 370.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[[(1-ethoxy-1-oxopropan-2-ylidene)amino]oxycarbonylamino]butanoic acid.
| Compound Name | 3-(4-chlorophenyl)-4-[[(1-ethoxy-1-oxopropan-2-ylidene)amino]oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 59365398 |
| Molecular Formula | C16H19ClN2O6 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[[(1-ethoxy-1-oxopropan-2-ylidene)amino]oxycarbonylamino]butanoic acid |
| SMILES | CCOC(=O)C(C)=NOC(=O)NCC(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN2O6/c1-3-24-15(22)10(2)19-25-16(23)18-9-12(8-14(20)21)11-4-6-13(17)7-5-11/h4-7,12H,3,8-9H2,1-2H3,(H,18,23)(H,20,21) |
| InChIKey | CSGRPWPYFLZLJP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|