C18H24ClNO6 — CID 90989841
(3R)-3-(4-chlorophenyl)-4-[1-(2-methylpropanoyloxy)propoxycarbonylamino]butanoic acid (PubChem CID 90989841) has the molecular formula C18H24ClNO6 and a molecular weight of 385.84 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-4-[1-(2-methylpropanoyloxy)propoxycarbonylamino]butanoic acid.
| Compound Name | (3R)-3-(4-chlorophenyl)-4-[1-(2-methylpropanoyloxy)propoxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 90989841 |
| Molecular Formula | C18H24ClNO6 |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-4-[1-(2-methylpropanoyloxy)propoxycarbonylamino]butanoic acid |
| SMILES | CCC(OC(=O)NC[C@H](CC(=O)O)c1ccc(Cl)cc1)OC(=O)C(C)C |
| InChI | InChI=1S/C18H24ClNO6/c1-4-16(25-17(23)11(2)3)26-18(24)20-10-13(9-15(21)22)12-5-7-14(19)8-6-12/h5-8,11,13,16H,4,9-10H2,1-3H3,(H,20,24)(H,21,22)/t13-,16?/m0/s1 |
| InChIKey | YFNCXSGIQJQDNM-KNVGNIICSA-N |
| XLogP | 3.56 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|