C15H20ClN3O4 — CID 154808714
2-[[4-[[(2S)-2-aminopropanoyl]amino]-3-(4-chlorophenyl)butanoyl]amino]acetic acid (PubChem CID 154808714) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is 2-[[4-[[(2S)-2-aminopropanoyl]amino]-3-(4-chlorophenyl)butanoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[(2S)-2-aminopropanoyl]amino]-3-(4-chlorophenyl)butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 154808714 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-[[4-[[(2S)-2-aminopropanoyl]amino]-3-(4-chlorophenyl)butanoyl]amino]acetic acid |
| SMILES | C[C@H](N)C(=O)NCC(CC(=O)NCC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClN3O4/c1-9(17)15(23)19-7-11(6-13(20)18-8-14(21)22)10-2-4-12(16)5-3-10/h2-5,9,11H,6-8,17H2,1H3,(H,18,20)(H,19,23)(H,21,22)/t9-,11?/m0/s1 |
| InChIKey | UMOVDAKOMCRRED-FTNKSUMCSA-N |
| XLogP | 0.48 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |