C16H23ClNO6P — CID 91514585
[(2R)-3-(1-butanoyloxyethoxycarbonylamino)-2-(4-chlorophenyl)propyl]phosphonous acid (PubChem CID 91514585) has the molecular formula C16H23ClNO6P and a molecular weight of 391.79 g/mol. Its IUPAC name is [(2R)-3-(1-butanoyloxyethoxycarbonylamino)-2-(4-chlorophenyl)propyl]phosphonous acid.
| Compound Name | [(2R)-3-(1-butanoyloxyethoxycarbonylamino)-2-(4-chlorophenyl)propyl]phosphonous acid |
|---|---|
| PubChem CID | 91514585 |
| Molecular Formula | C16H23ClNO6P |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [(2R)-3-(1-butanoyloxyethoxycarbonylamino)-2-(4-chlorophenyl)propyl]phosphonous acid |
| SMILES | CCCC(=O)OC(C)OC(=O)NC[C@H](CP(O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H23ClNO6P/c1-3-4-15(19)23-11(2)24-16(20)18-9-13(10-25(21)22)12-5-7-14(17)8-6-12/h5-8,11,13,21-22H,3-4,9-10H2,1-2H3,(H,18,20)/t11?,13-/m1/s1 |
| InChIKey | SKLSWADJWXSEQX-GLGOKHISSA-N |
| XLogP | 3.14 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|