C17H25ClNO6P — CID 67199504
[3-(1-butanoyloxyethoxycarbonylamino)-1-(4-chlorophenyl)propyl]-methylphosphinic acid (PubChem CID 67199504) has the molecular formula C17H25ClNO6P and a molecular weight of 405.82 g/mol. Its IUPAC name is [3-(1-butanoyloxyethoxycarbonylamino)-1-(4-chlorophenyl)propyl]-methylphosphinic acid.
| Compound Name | [3-(1-butanoyloxyethoxycarbonylamino)-1-(4-chlorophenyl)propyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 67199504 |
| Molecular Formula | C17H25ClNO6P |
| Molecular Weight | 405.82 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [3-(1-butanoyloxyethoxycarbonylamino)-1-(4-chlorophenyl)propyl]-methylphosphinic acid |
| SMILES | CCCC(=O)OC(C)OC(=O)NCCC(c1ccc(Cl)cc1)P(C)(=O)O |
| InChI | InChI=1S/C17H25ClNO6P/c1-4-5-16(20)24-12(2)25-17(21)19-11-10-15(26(3,22)23)13-6-8-14(18)9-7-13/h6-9,12,15H,4-5,10-11H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | YNJFEENPGCBAEH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|