C14H29NNaO6P — CID 173084025
sodium;3-(1-butanoyloxyethoxycarbonylamino)propyl-butylphosphinic acid;hydride (PubChem CID 173084025) has the molecular formula C14H29NNaO6P and a molecular weight of 361.35 g/mol. Its IUPAC name is sodium;3-(1-butanoyloxyethoxycarbonylamino)propyl-butylphosphinic acid;hydride.
| Compound Name | sodium;3-(1-butanoyloxyethoxycarbonylamino)propyl-butylphosphinic acid;hydride |
|---|---|
| PubChem CID | 173084025 |
| Molecular Formula | C14H29NNaO6P |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | sodium;3-(1-butanoyloxyethoxycarbonylamino)propyl-butylphosphinic acid;hydride |
| SMILES | CCCCP(=O)(O)CCCNC(=O)OC(C)OC(=O)CCC.[H-].[Na+] |
| InChI | InChI=1S/C14H28NO6P.Na.H/c1-4-6-10-22(18,19)11-7-9-15-14(17)21-12(3)20-13(16)8-5-2;;/h12H,4-11H2,1-3H3,(H,15,17)(H,18,19);;/q;+1;-1 |
| InChIKey | YGPDVIBNZDYMQZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|