C18H24ClNO6 — CID 66754617
2-(4-chlorophenyl)-4-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]butanoic acid (PubChem CID 66754617) has the molecular formula C18H24ClNO6 and a molecular weight of 385.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]butanoic acid.
| Compound Name | 2-(4-chlorophenyl)-4-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 66754617 |
| Molecular Formula | C18H24ClNO6 |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]butanoic acid |
| SMILES | CC(OC(=O)NCCC(C(=O)O)c1ccc(Cl)cc1)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H24ClNO6/c1-11(25-16(23)18(2,3)4)26-17(24)20-10-9-14(15(21)22)12-5-7-13(19)8-6-12/h5-8,11,14H,9-10H2,1-4H3,(H,20,24)(H,21,22) |
| InChIKey | GAYADYVMVVCMKZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|