C14H16ClNO6 — CID 66752917
4-(acetyloxymethoxycarbonylamino)-2-(4-chlorophenyl)butanoic acid (PubChem CID 66752917) has the molecular formula C14H16ClNO6 and a molecular weight of 329.74 g/mol. Its IUPAC name is 4-(acetyloxymethoxycarbonylamino)-2-(4-chlorophenyl)butanoic acid.
| Compound Name | 4-(acetyloxymethoxycarbonylamino)-2-(4-chlorophenyl)butanoic acid |
|---|---|
| PubChem CID | 66752917 |
| Molecular Formula | C14H16ClNO6 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-(acetyloxymethoxycarbonylamino)-2-(4-chlorophenyl)butanoic acid |
| SMILES | CC(=O)OCOC(=O)NCCC(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClNO6/c1-9(17)21-8-22-14(20)16-7-6-12(13(18)19)10-2-4-11(15)5-3-10/h2-5,12H,6-8H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | UTMKZCYPDIHOFD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|