C14H15ClNNaO6 — CID 66752918
sodium 4-(acetyloxymethoxycarbonylamino)-4-(4-chlorophenyl)butanoate (PubChem CID 66752918) has the molecular formula C14H15ClNNaO6 and a molecular weight of 351.72 g/mol. Its IUPAC name is sodium 4-(acetyloxymethoxycarbonylamino)-4-(4-chlorophenyl)butanoate.
| Compound Name | sodium 4-(acetyloxymethoxycarbonylamino)-4-(4-chlorophenyl)butanoate |
|---|---|
| PubChem CID | 66752918 |
| Molecular Formula | C14H15ClNNaO6 |
| Molecular Weight | 351.72 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | sodium 4-(acetyloxymethoxycarbonylamino)-4-(4-chlorophenyl)butanoate |
| SMILES | CC(=O)OCOC(=O)NC(CCC(=O)[O-])c1ccc(Cl)cc1.[Na+] |
| InChI | InChI=1S/C14H16ClNO6.Na/c1-9(17)21-8-22-14(20)16-12(6-7-13(18)19)10-2-4-11(15)5-3-10;/h2-5,12H,6-8H2,1H3,(H,16,20)(H,18,19);/q;+1/p-1 |
| InChIKey | WPMHHNXHYXWOKL-UHFFFAOYSA-M |
| XLogP | -1.84 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.72 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|