C18H23ClNNaO6 — CID 66753375
sodium 4-(4-chlorophenyl)-4-[(2-methyl-1-propanoyloxypropoxy)carbonylamino]butanoate (PubChem CID 66753375) has the molecular formula C18H23ClNNaO6 and a molecular weight of 407.83 g/mol. Its IUPAC name is sodium 4-(4-chlorophenyl)-4-[(2-methyl-1-propanoyloxypropoxy)carbonylamino]butanoate.
| Compound Name | sodium 4-(4-chlorophenyl)-4-[(2-methyl-1-propanoyloxypropoxy)carbonylamino]butanoate |
|---|---|
| PubChem CID | 66753375 |
| Molecular Formula | C18H23ClNNaO6 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | sodium 4-(4-chlorophenyl)-4-[(2-methyl-1-propanoyloxypropoxy)carbonylamino]butanoate |
| SMILES | CCC(=O)OC(OC(=O)NC(CCC(=O)[O-])c1ccc(Cl)cc1)C(C)C.[Na+] |
| InChI | InChI=1S/C18H24ClNO6.Na/c1-4-16(23)25-17(11(2)3)26-18(24)20-14(9-10-15(21)22)12-5-7-13(19)8-6-12;/h5-8,11,14,17H,4,9-10H2,1-3H3,(H,20,24)(H,21,22);/q;+1/p-1 |
| InChIKey | NVFXHHKSPSRIMX-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|