C29H30ClNO6 — CID 66754059
[1-[[1-(4-chlorophenyl)-4-oxo-4-phenylmethoxybutyl]carbamoyloxy]-2-methylpropyl] benzoate (PubChem CID 66754059) has the molecular formula C29H30ClNO6 and a molecular weight of 524.01 g/mol. Its IUPAC name is [1-[[1-(4-chlorophenyl)-4-oxo-4-phenylmethoxybutyl]carbamoyloxy]-2-methylpropyl] benzoate.
| Compound Name | [1-[[1-(4-chlorophenyl)-4-oxo-4-phenylmethoxybutyl]carbamoyloxy]-2-methylpropyl] benzoate |
|---|---|
| PubChem CID | 66754059 |
| Molecular Formula | C29H30ClNO6 |
| Molecular Weight | 524.01 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [1-[[1-(4-chlorophenyl)-4-oxo-4-phenylmethoxybutyl]carbamoyloxy]-2-methylpropyl] benzoate |
| SMILES | CC(C)C(OC(=O)NC(CCC(=O)OCc1ccccc1)c1ccc(Cl)cc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H30ClNO6/c1-20(2)28(36-27(33)23-11-7-4-8-12-23)37-29(34)31-25(22-13-15-24(30)16-14-22)17-18-26(32)35-19-21-9-5-3-6-10-21/h3-16,20,25,28H,17-19H2,1-2H3,(H,31,34) |
| InChIKey | QLARSUGEOPRJQB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.01 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|