C18H23Cl2NO6 — CID 67173002
(2S)-2-[(2,5-dichlorophenyl)methyl]-3-[[(1S)-2-methyl-1-propanoyloxypropoxy]carbonylamino]propanoic acid (PubChem CID 67173002) has the molecular formula C18H23Cl2NO6 and a molecular weight of 420.29 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichlorophenyl)methyl]-3-[[(1S)-2-methyl-1-propanoyloxypropoxy]carbonylamino]propanoic acid.
| Compound Name | (2S)-2-[(2,5-dichlorophenyl)methyl]-3-[[(1S)-2-methyl-1-propanoyloxypropoxy]carbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67173002 |
| Molecular Formula | C18H23Cl2NO6 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (2S)-2-[(2,5-dichlorophenyl)methyl]-3-[[(1S)-2-methyl-1-propanoyloxypropoxy]carbonylamino]propanoic acid |
| SMILES | CCC(=O)O[C@@H](OC(=O)NC[C@H](Cc1cc(Cl)ccc1Cl)C(=O)O)C(C)C |
| InChI | InChI=1S/C18H23Cl2NO6/c1-4-15(22)26-17(10(2)3)27-18(25)21-9-12(16(23)24)7-11-8-13(19)5-6-14(11)20/h5-6,8,10,12,17H,4,7,9H2,1-3H3,(H,21,25)(H,23,24)/t12-,17-/m0/s1 |
| InChIKey | QWOXTOFNBMUBFA-SJCJKPOMSA-N |
| XLogP | 3.90 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|