C17H25NO6S — CID 67170636
(2S)-2-[[[(1R)-2-methyl-1-propanoyloxypropoxy]carbonylamino]methyl]-3-(3-methylthiophen-2-yl)propanoic acid (PubChem CID 67170636) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is (2S)-2-[[[(1R)-2-methyl-1-propanoyloxypropoxy]carbonylamino]methyl]-3-(3-methylthiophen-2-yl)propanoic acid.
| Compound Name | (2S)-2-[[[(1R)-2-methyl-1-propanoyloxypropoxy]carbonylamino]methyl]-3-(3-methylthiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 67170636 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (2S)-2-[[[(1R)-2-methyl-1-propanoyloxypropoxy]carbonylamino]methyl]-3-(3-methylthiophen-2-yl)propanoic acid |
| SMILES | CCC(=O)O[C@H](OC(=O)NC[C@H](Cc1sccc1C)C(=O)O)C(C)C |
| InChI | InChI=1S/C17H25NO6S/c1-5-14(19)23-16(10(2)3)24-17(22)18-9-12(15(20)21)8-13-11(4)6-7-25-13/h6-7,10,12,16H,5,8-9H2,1-4H3,(H,18,22)(H,20,21)/t12-,16+/m0/s1 |
| InChIKey | HVVLWYAIDYMGQZ-BLLLJJGKSA-N |
| XLogP | 2.96 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|