C14H14O2S — CID 79014830
3-(3-methylthiophen-2-yl)-2-phenylpropanoic acid (PubChem CID 79014830) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 3-(3-methylthiophen-2-yl)-2-phenylpropanoic acid.
| Compound Name | 3-(3-methylthiophen-2-yl)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 79014830 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-(3-methylthiophen-2-yl)-2-phenylpropanoic acid |
| SMILES | Cc1ccsc1CC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H14O2S/c1-10-7-8-17-13(10)9-12(14(15)16)11-5-3-2-4-6-11/h2-8,12H,9H2,1H3,(H,15,16) |
| InChIKey | CJSVFXFKXZJXCO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |