C9H12O2S — CID 79991313
2-(3-methylthiophen-2-yl)butanoic acid (PubChem CID 79991313) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-(3-methylthiophen-2-yl)butanoic acid.
| Compound Name | 2-(3-methylthiophen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 79991313 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-(3-methylthiophen-2-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1sccc1C |
| InChI | InChI=1S/C9H12O2S/c1-3-7(9(10)11)8-6(2)4-5-12-8/h4-5,7H,3H2,1-2H3,(H,10,11) |
| InChIKey | GLYAZUCVMJUZJG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |