C9H12O4S — CID 171877069
3,4-dihydroxy-4-(3-methylthiophen-2-yl)butanoic acid (PubChem CID 171877069) has the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(3-methylthiophen-2-yl)butanoic acid.
| Compound Name | 3,4-dihydroxy-4-(3-methylthiophen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 171877069 |
| Molecular Formula | C9H12O4S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3,4-dihydroxy-4-(3-methylthiophen-2-yl)butanoic acid |
| SMILES | Cc1ccsc1C(O)C(O)CC(=O)O |
| InChI | InChI=1S/C9H12O4S/c1-5-2-3-14-9(5)8(13)6(10)4-7(11)12/h2-3,6,8,10,13H,4H2,1H3,(H,11,12) |
| InChIKey | WHZDQFLHPSUJFD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |