C9H15NO2S — CID 83929127
2-amino-1-(3-methylthiophen-2-yl)butane-1,4-diol (PubChem CID 83929127) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-amino-1-(3-methylthiophen-2-yl)butane-1,4-diol.
| Compound Name | 2-amino-1-(3-methylthiophen-2-yl)butane-1,4-diol |
|---|---|
| PubChem CID | 83929127 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-amino-1-(3-methylthiophen-2-yl)butane-1,4-diol |
| SMILES | Cc1ccsc1C(O)C(N)CCO |
| InChI | InChI=1S/C9H15NO2S/c1-6-3-5-13-9(6)8(12)7(10)2-4-11/h3,5,7-8,11-12H,2,4,10H2,1H3 |
| InChIKey | AAFNVRPDFHAIBE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |