C8H14N2OS — CID 116942474
2,3-diamino-3-(3-methylthiophen-2-yl)propan-1-ol (PubChem CID 116942474) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 2,3-diamino-3-(3-methylthiophen-2-yl)propan-1-ol.
| Compound Name | 2,3-diamino-3-(3-methylthiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 116942474 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2,3-diamino-3-(3-methylthiophen-2-yl)propan-1-ol |
| SMILES | Cc1ccsc1C(N)C(N)CO |
| InChI | InChI=1S/C8H14N2OS/c1-5-2-3-12-8(5)7(10)6(9)4-11/h2-3,6-7,11H,4,9-10H2,1H3 |
| InChIKey | ZMIJVPIIBQEIIA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |