About (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine
(1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine (PubChem CID 130649294) has the molecular formula C7H9F2NS
and a molecular weight of 177.22 g/mol. Its IUPAC name is (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine.
Analyze (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine?
The IUPAC name of (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine (CID 130649294) is (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine.
What is the SMILES notation for (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine?
The canonical SMILES for (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine is Cc1ccsc1[C@@H](N)C(F)F.
What is the InChIKey of (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine?
The InChIKey is XBXZIBAXWBIWNK-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H9F2NS/c1-4-2-3-11-6(4)5(10)7(8)9/h2-3,5,7H,10H2,1H3/t5-/m1/s1.
What are the key properties of (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine?
(1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine has a molecular weight of 177.22 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,2-difluoro-1-(3-methylthiophen-2-yl)ethanamine is sourced from PubChem (CID 130649294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).