C8H12N2OS — CID 43147956
3-amino-3-(3-methylthiophen-2-yl)propanamide (PubChem CID 43147956) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 3-amino-3-(3-methylthiophen-2-yl)propanamide.
| Compound Name | 3-amino-3-(3-methylthiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 43147956 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-amino-3-(3-methylthiophen-2-yl)propanamide |
| SMILES | Cc1ccsc1C(N)CC(N)=O |
| InChI | InChI=1S/C8H12N2OS/c1-5-2-3-12-8(5)6(9)4-7(10)11/h2-3,6H,4,9H2,1H3,(H2,10,11) |
| InChIKey | RCVLUBWCYDSDKY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |