C10H16N2O2S — CID 115241731
3-amino-4-[(3-methylthiophen-2-yl)methylamino]butanoic acid (PubChem CID 115241731) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-amino-4-[(3-methylthiophen-2-yl)methylamino]butanoic acid.
| Compound Name | 3-amino-4-[(3-methylthiophen-2-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 115241731 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-amino-4-[(3-methylthiophen-2-yl)methylamino]butanoic acid |
| SMILES | Cc1ccsc1CNCC(N)CC(=O)O |
| InChI | InChI=1S/C10H16N2O2S/c1-7-2-3-15-9(7)6-12-5-8(11)4-10(13)14/h2-3,8,12H,4-6,11H2,1H3,(H,13,14) |
| InChIKey | QOEWZDISKXGQOD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |