C11H16N2O3S — CID 115181342
3-amino-4-[2-(3-methylthiophen-2-yl)ethylamino]-4-oxobutanoic acid (PubChem CID 115181342) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-amino-4-[2-(3-methylthiophen-2-yl)ethylamino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[2-(3-methylthiophen-2-yl)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 115181342 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-amino-4-[2-(3-methylthiophen-2-yl)ethylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccsc1CCNC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C11H16N2O3S/c1-7-3-5-17-9(7)2-4-13-11(16)8(12)6-10(14)15/h3,5,8H,2,4,6,12H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | DERBDCQWFCIQPN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |