C9H13NO2S — CID 115190738
methyl N-[2-(3-methylthiophen-2-yl)ethyl]carbamate (PubChem CID 115190738) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is methyl N-[2-(3-methylthiophen-2-yl)ethyl]carbamate.
| Compound Name | methyl N-[2-(3-methylthiophen-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 115190738 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | methyl N-[2-(3-methylthiophen-2-yl)ethyl]carbamate |
| SMILES | COC(=O)NCCc1sccc1C |
| InChI | InChI=1S/C9H13NO2S/c1-7-4-6-13-8(7)3-5-10-9(11)12-2/h4,6H,3,5H2,1-2H3,(H,10,11) |
| InChIKey | UBQKVWSSJZNQRI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |