C10H16N2OS — CID 115152050
2-(methylamino)-N-[2-(3-methylthiophen-2-yl)ethyl]acetamide (PubChem CID 115152050) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(methylamino)-N-[2-(3-methylthiophen-2-yl)ethyl]acetamide.
| Compound Name | 2-(methylamino)-N-[2-(3-methylthiophen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 115152050 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(methylamino)-N-[2-(3-methylthiophen-2-yl)ethyl]acetamide |
| SMILES | CNCC(=O)NCCc1sccc1C |
| InChI | InChI=1S/C10H16N2OS/c1-8-4-6-14-9(8)3-5-12-10(13)7-11-2/h4,6,11H,3,5,7H2,1-2H3,(H,12,13) |
| InChIKey | KAYPZWATBCSDRC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |