C10H13NO3S — CID 115142589
methyl 2-[2-(3-methylthiophen-2-yl)ethylamino]-2-oxoacetate (PubChem CID 115142589) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is methyl 2-[2-(3-methylthiophen-2-yl)ethylamino]-2-oxoacetate.
| Compound Name | methyl 2-[2-(3-methylthiophen-2-yl)ethylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 115142589 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | methyl 2-[2-(3-methylthiophen-2-yl)ethylamino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCCc1sccc1C |
| InChI | InChI=1S/C10H13NO3S/c1-7-4-6-15-8(7)3-5-11-9(12)10(13)14-2/h4,6H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | IVKWCESOZUDTQQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|