C8H11NOS — CID 115223017
2-[(3-methylthiophen-2-yl)methylamino]acetaldehyde (PubChem CID 115223017) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 2-[(3-methylthiophen-2-yl)methylamino]acetaldehyde.
| Compound Name | 2-[(3-methylthiophen-2-yl)methylamino]acetaldehyde |
|---|---|
| PubChem CID | 115223017 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2-[(3-methylthiophen-2-yl)methylamino]acetaldehyde |
| SMILES | Cc1ccsc1CNCC=O |
| InChI | InChI=1S/C8H11NOS/c1-7-2-5-11-8(7)6-9-3-4-10/h2,4-5,9H,3,6H2,1H3 |
| InChIKey | RYRUYCARDFLTAH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|