C8H14N2S — CID 83003822
1,1-dimethyl-2-[(3-methylthiophen-2-yl)methyl]hydrazine (PubChem CID 83003822) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(3-methylthiophen-2-yl)methyl]hydrazine.
| Compound Name | 1,1-dimethyl-2-[(3-methylthiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 83003822 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1,1-dimethyl-2-[(3-methylthiophen-2-yl)methyl]hydrazine |
| SMILES | Cc1ccsc1CNN(C)C |
| InChI | InChI=1S/C8H14N2S/c1-7-4-5-11-8(7)6-9-10(2)3/h4-5,9H,6H2,1-3H3 |
| InChIKey | DPULYFOTQQPBRW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|