C14H17NS — CID 115749452
2,6-dimethyl-N-[(3-methylthiophen-2-yl)methyl]aniline (PubChem CID 115749452) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(3-methylthiophen-2-yl)methyl]aniline.
| Compound Name | 2,6-dimethyl-N-[(3-methylthiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 115749452 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2,6-dimethyl-N-[(3-methylthiophen-2-yl)methyl]aniline |
| SMILES | Cc1ccsc1CNc1c(C)cccc1C |
| InChI | InChI=1S/C14H17NS/c1-10-7-8-16-13(10)9-15-14-11(2)5-4-6-12(14)3/h4-8,15H,9H2,1-3H3 |
| InChIKey | LSJFEIRACQHULG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |