C15H15N3S — CID 34013980
3-methyl-N-[(3-methylthiophen-2-yl)methyl]quinoxalin-2-amine (PubChem CID 34013980) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 3-methyl-N-[(3-methylthiophen-2-yl)methyl]quinoxalin-2-amine.
| Compound Name | 3-methyl-N-[(3-methylthiophen-2-yl)methyl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 34013980 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3-methyl-N-[(3-methylthiophen-2-yl)methyl]quinoxalin-2-amine |
| SMILES | Cc1ccsc1CNc1nc2ccccc2nc1C |
| InChI | InChI=1S/C15H15N3S/c1-10-7-8-19-14(10)9-16-15-11(2)17-12-5-3-4-6-13(12)18-15/h3-8H,9H2,1-2H3,(H,16,18) |
| InChIKey | TWEGAPQUKBEFMY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |