C15H17N3S — CID 7342846
1-ethyl-N-[(3-methylthiophen-2-yl)methyl]benzimidazol-2-amine (PubChem CID 7342846) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-ethyl-N-[(3-methylthiophen-2-yl)methyl]benzimidazol-2-amine.
| Compound Name | 1-ethyl-N-[(3-methylthiophen-2-yl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 7342846 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-ethyl-N-[(3-methylthiophen-2-yl)methyl]benzimidazol-2-amine |
| SMILES | CCn1c(NCc2sccc2C)nc2ccccc21 |
| InChI | InChI=1S/C15H17N3S/c1-3-18-13-7-5-4-6-12(13)17-15(18)16-10-14-11(2)8-9-19-14/h4-9H,3,10H2,1-2H3,(H,16,17) |
| InChIKey | NZGJHADOZHVNFO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |