C16H16BrN3O — CID 787412
4-bromo-2-[[(1-ethylbenzimidazol-2-yl)amino]methyl]phenol (PubChem CID 787412) has the molecular formula C16H16BrN3O and a molecular weight of 346.23 g/mol. Its IUPAC name is 4-bromo-2-[[(1-ethylbenzimidazol-2-yl)amino]methyl]phenol.
| Compound Name | 4-bromo-2-[[(1-ethylbenzimidazol-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 787412 |
| Molecular Formula | C16H16BrN3O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-bromo-2-[[(1-ethylbenzimidazol-2-yl)amino]methyl]phenol |
| SMILES | CCn1c(NCc2cc(Br)ccc2O)nc2ccccc21 |
| InChI | InChI=1S/C16H16BrN3O/c1-2-20-14-6-4-3-5-13(14)19-16(20)18-10-11-9-12(17)7-8-15(11)21/h3-9,21H,2,10H2,1H3,(H,18,19) |
| InChIKey | GUVFPFMXZFAHAM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|