C20H24ClN3O — CID 4592910
4-chloro-2-[[(1-hexylbenzimidazol-2-yl)amino]methyl]phenol (PubChem CID 4592910) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 4-chloro-2-[[(1-hexylbenzimidazol-2-yl)amino]methyl]phenol.
| Compound Name | 4-chloro-2-[[(1-hexylbenzimidazol-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 4592910 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-chloro-2-[[(1-hexylbenzimidazol-2-yl)amino]methyl]phenol |
| SMILES | CCCCCCn1c(NCc2cc(Cl)ccc2O)nc2ccccc21 |
| InChI | InChI=1S/C20H24ClN3O/c1-2-3-4-7-12-24-18-9-6-5-8-17(18)23-20(24)22-14-15-13-16(21)10-11-19(15)25/h5-6,8-11,13,25H,2-4,7,12,14H2,1H3,(H,22,23) |
| InChIKey | IBYFXTJEDKIZSJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|