C18H19Br2N3O — CID 3736134
2,4-dibromo-6-[[(1-butylbenzimidazol-2-yl)amino]methyl]phenol (PubChem CID 3736134) has the molecular formula C18H19Br2N3O and a molecular weight of 453.18 g/mol. Its IUPAC name is 2,4-dibromo-6-[[(1-butylbenzimidazol-2-yl)amino]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[[(1-butylbenzimidazol-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 3736134 |
| Molecular Formula | C18H19Br2N3O |
| Molecular Weight | 453.18 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 2,4-dibromo-6-[[(1-butylbenzimidazol-2-yl)amino]methyl]phenol |
| SMILES | CCCCn1c(NCc2cc(Br)cc(Br)c2O)nc2ccccc21 |
| InChI | InChI=1S/C18H19Br2N3O/c1-2-3-8-23-16-7-5-4-6-15(16)22-18(23)21-11-12-9-13(19)10-14(20)17(12)24/h4-7,9-10,24H,2-3,8,11H2,1H3,(H,21,22) |
| InChIKey | QFLUAXMDPGUTGF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.18 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|