C20H25N3O2 — CID 4265206
1-butyl-N-[(2,3-dimethoxyphenyl)methyl]benzimidazol-2-amine (PubChem CID 4265206) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-butyl-N-[(2,3-dimethoxyphenyl)methyl]benzimidazol-2-amine.
| Compound Name | 1-butyl-N-[(2,3-dimethoxyphenyl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 4265206 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-butyl-N-[(2,3-dimethoxyphenyl)methyl]benzimidazol-2-amine |
| SMILES | CCCCn1c(NCc2cccc(OC)c2OC)nc2ccccc21 |
| InChI | InChI=1S/C20H25N3O2/c1-4-5-13-23-17-11-7-6-10-16(17)22-20(23)21-14-15-9-8-12-18(24-2)19(15)25-3/h6-12H,4-5,13-14H2,1-3H3,(H,21,22) |
| InChIKey | GZLQUQSOMHOETJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |