C12H18N4 — CID 4136867
(1-pentylbenzimidazol-2-yl)hydrazine (PubChem CID 4136867) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1-pentylbenzimidazol-2-yl)hydrazine.
| Compound Name | (1-pentylbenzimidazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 4136867 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (1-pentylbenzimidazol-2-yl)hydrazine |
| SMILES | CCCCCn1c(NN)nc2ccccc21 |
| InChI | InChI=1S/C12H18N4/c1-2-3-6-9-16-11-8-5-4-7-10(11)14-12(16)15-13/h4-5,7-8H,2-3,6,9,13H2,1H3,(H,14,15) |
| InChIKey | GIHFCKJPXVCLEJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|