C22H30N4 — CID 4697855
4-N,4-N-diethyl-1-N-(1-pentylbenzimidazol-2-yl)benzene-1,4-diamine (PubChem CID 4697855) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-(1-pentylbenzimidazol-2-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-(1-pentylbenzimidazol-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 4697855 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-(1-pentylbenzimidazol-2-yl)benzene-1,4-diamine |
| SMILES | CCCCCn1c(Nc2ccc(N(CC)CC)cc2)nc2ccccc21 |
| InChI | InChI=1S/C22H30N4/c1-4-7-10-17-26-21-12-9-8-11-20(21)24-22(26)23-18-13-15-19(16-14-18)25(5-2)6-3/h8-9,11-16H,4-7,10,17H2,1-3H3,(H,23,24) |
| InChIKey | CFVAVNWPVJKMAP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|