C24H36N5+ — CID 7010805
2-[2-[[4-(diethylamino)phenyl]methylamino]benzimidazol-1-yl]ethyl-diethylazanium (PubChem CID 7010805) has the molecular formula C24H36N5+ and a molecular weight of 394.59 g/mol. Its IUPAC name is 2-[2-[[4-(diethylamino)phenyl]methylamino]benzimidazol-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[2-[[4-(diethylamino)phenyl]methylamino]benzimidazol-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7010805 |
| Molecular Formula | C24H36N5+ |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 2-[2-[[4-(diethylamino)phenyl]methylamino]benzimidazol-1-yl]ethyl-diethylazanium |
| SMILES | CCN(CC)c1ccc(CNc2nc3ccccc3n2CC[NH+](CC)CC)cc1 |
| InChI | InChI=1S/C24H35N5/c1-5-27(6-2)17-18-29-23-12-10-9-11-22(23)26-24(29)25-19-20-13-15-21(16-14-20)28(7-3)8-4/h9-16H,5-8,17-19H2,1-4H3,(H,25,26)/p+1 |
| InChIKey | VOCNMIJDJPPBIF-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|