C21H27N4O2+ — CID 7423926
diethyl-[2-[2-[(2-phenoxyacetyl)amino]benzimidazol-1-yl]ethyl]azanium (PubChem CID 7423926) has the molecular formula C21H27N4O2+ and a molecular weight of 367.47 g/mol. Its IUPAC name is diethyl-[2-[2-[(2-phenoxyacetyl)amino]benzimidazol-1-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[2-[(2-phenoxyacetyl)amino]benzimidazol-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7423926 |
| Molecular Formula | C21H27N4O2+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | diethyl-[2-[2-[(2-phenoxyacetyl)amino]benzimidazol-1-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CCn1c(NC(=O)COc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C21H26N4O2/c1-3-24(4-2)14-15-25-19-13-9-8-12-18(19)22-21(25)23-20(26)16-27-17-10-6-5-7-11-17/h5-13H,3-4,14-16H2,1-2H3,(H,22,23,26)/p+1 |
| InChIKey | CAQVCQBSYMEKQO-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 60.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |