C22H30N5O+ — CID 7342816
N-[[4-(dimethylamino)phenyl]methyl]-1-(2-morpholin-4-ium-4-ylethyl)benzimidazol-2-amine (PubChem CID 7342816) has the molecular formula C22H30N5O+ and a molecular weight of 380.52 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1-(2-morpholin-4-ium-4-ylethyl)benzimidazol-2-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1-(2-morpholin-4-ium-4-ylethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 7342816 |
| Molecular Formula | C22H30N5O+ |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1-(2-morpholin-4-ium-4-ylethyl)benzimidazol-2-amine |
| SMILES | CN(C)c1ccc(CNc2nc3ccccc3n2CC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29N5O/c1-25(2)19-9-7-18(8-10-19)17-23-22-24-20-5-3-4-6-21(20)27(22)12-11-26-13-15-28-16-14-26/h3-10H,11-17H2,1-2H3,(H,23,24)/p+1 |
| InChIKey | JWXOPZMSWSIVNG-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|