C22H31N7O — CID 75446132
1-[2-(diethylamino)ethyl]-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]benzimidazol-2-amine (PubChem CID 75446132) has the molecular formula C22H31N7O and a molecular weight of 409.54 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]benzimidazol-2-amine.
| Compound Name | 1-[2-(diethylamino)ethyl]-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 75446132 |
| Molecular Formula | C22H31N7O |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]benzimidazol-2-amine |
| SMILES | CCN(CC)CCn1c(NCc2cnc(N3CCOCC3)nc2)nc2ccccc21 |
| InChI | InChI=1S/C22H31N7O/c1-3-27(4-2)9-10-29-20-8-6-5-7-19(20)26-22(29)25-17-18-15-23-21(24-16-18)28-11-13-30-14-12-28/h5-8,15-16H,3-4,9-14,17H2,1-2H3,(H,25,26) |
| InChIKey | NTNBUTHIRFDKIR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |