C25H33N5O — CID 56556521
N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-phenyl-2-pyrrolidin-1-ylacetamide (PubChem CID 56556521) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-phenyl-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-phenyl-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 56556521 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-phenyl-2-pyrrolidin-1-ylacetamide |
| SMILES | CCN(CC)CCn1c(NC(=O)C(c2ccccc2)N2CCCC2)nc2ccccc21 |
| InChI | InChI=1S/C25H33N5O/c1-3-28(4-2)18-19-30-22-15-9-8-14-21(22)26-25(30)27-24(31)23(29-16-10-11-17-29)20-12-6-5-7-13-20/h5-9,12-15,23H,3-4,10-11,16-19H2,1-2H3,(H,26,27,31) |
| InChIKey | FYYGVCWYYLNLCS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |