C23H31N5O3 — CID 40604553
2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]acetamide (PubChem CID 40604553) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]acetamide.
| Compound Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]acetamide |
|---|---|
| PubChem CID | 40604553 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]acetamide |
| SMILES | CCN(CC)CCn1c(NC(=O)CN2C(=O)[C@H]3CCCC[C@@H]3C2=O)nc2ccccc21 |
| InChI | InChI=1S/C23H31N5O3/c1-3-26(4-2)13-14-27-19-12-8-7-11-18(19)24-23(27)25-20(29)15-28-21(30)16-9-5-6-10-17(16)22(28)31/h7-8,11-12,16-17H,3-6,9-10,13-15H2,1-2H3,(H,24,25,29)/t16-,17-/m0/s1 |
| InChIKey | FATJGJMVWKGCES-IRXDYDNUSA-N |
| XLogP | 2.49 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|