C19H19N3O3 — CID 94820253
2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-quinolin-2-ylacetamide (PubChem CID 94820253) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-quinolin-2-ylacetamide.
| Compound Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-quinolin-2-ylacetamide |
|---|---|
| PubChem CID | 94820253 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-quinolin-2-ylacetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CCCC[C@@H]2C1=O)Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H19N3O3/c23-17(21-16-10-9-12-5-1-4-8-15(12)20-16)11-22-18(24)13-6-2-3-7-14(13)19(22)25/h1,4-5,8-10,13-14H,2-3,6-7,11H2,(H,20,21,23)/t13-,14-/m0/s1 |
| InChIKey | AVPBYDMTRXOPFF-KBPBESRZSA-N |
| XLogP | 2.35 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|