C24H30N4O3 — CID 46654985
2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-quinolin-2-ylacetamide (PubChem CID 46654985) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-quinolin-2-ylacetamide.
| Compound Name | 2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-quinolin-2-ylacetamide |
|---|---|
| PubChem CID | 46654985 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-quinolin-2-ylacetamide |
| SMILES | CCC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccc3ccccc3n1)C2=O |
| InChI | InChI=1S/C24H30N4O3/c1-4-23(2,3)17-11-13-24(14-12-17)21(30)28(22(31)27-24)15-20(29)26-19-10-9-16-7-5-6-8-18(16)25-19/h5-10,17H,4,11-15H2,1-3H3,(H,27,31)(H,25,26,29) |
| InChIKey | QXJQUVHNWNTAGT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|