C22H32N4O5S — CID 30830922
N-[3-(methanesulfonamido)phenyl]-2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 30830922) has the molecular formula C22H32N4O5S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)phenyl]-2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[3-(methanesulfonamido)phenyl]-2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 30830922 |
| Molecular Formula | C22H32N4O5S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[3-(methanesulfonamido)phenyl]-2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)Nc1cccc(NS(C)(=O)=O)c1)C2=O |
| InChI | InChI=1S/C22H32N4O5S/c1-5-21(2,3)15-9-11-22(12-10-15)19(28)26(20(29)24-22)14-18(27)23-16-7-6-8-17(13-16)25-32(4,30)31/h6-8,13,15,25H,5,9-12,14H2,1-4H3,(H,23,27)(H,24,29) |
| InChIKey | OLYQZTVHPRBOKF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|