C26H36N4O5 — CID 55748943
2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[3-(morpholine-4-carbonyl)phenyl]acetamide (PubChem CID 55748943) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[3-(morpholine-4-carbonyl)phenyl]acetamide.
| Compound Name | 2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[3-(morpholine-4-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55748943 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[3-(morpholine-4-carbonyl)phenyl]acetamide |
| SMILES | CCC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)Nc1cccc(C(=O)N3CCOCC3)c1)C2=O |
| InChI | InChI=1S/C26H36N4O5/c1-4-25(2,3)19-8-10-26(11-9-19)23(33)30(24(34)28-26)17-21(31)27-20-7-5-6-18(16-20)22(32)29-12-14-35-15-13-29/h5-7,16,19H,4,8-15,17H2,1-3H3,(H,27,31)(H,28,34) |
| InChIKey | ONUPCLNLGYHFEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|