C24H32N4O4 — CID 36947132
2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 36947132) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 36947132 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)Nc1cccc(N3CCCC3=O)c1)C2=O |
| InChI | InChI=1S/C24H32N4O4/c1-23(2,3)16-9-11-24(12-10-16)21(31)28(22(32)26-24)15-19(29)25-17-6-4-7-18(14-17)27-13-5-8-20(27)30/h4,6-7,14,16H,5,8-13,15H2,1-3H3,(H,25,29)(H,26,32) |
| InChIKey | OKBZHXJVKKKNKG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|