C23H31N3O6 — CID 56543356
methyl 2-hydroxy-3-[[2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]benzoate (PubChem CID 56543356) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 56543356 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | methyl 2-hydroxy-3-[[2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]benzoate |
| SMILES | CCC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)Nc1cccc(C(=O)OC)c1O)C2=O |
| InChI | InChI=1S/C23H31N3O6/c1-5-22(2,3)14-9-11-23(12-10-14)20(30)26(21(31)25-23)13-17(27)24-16-8-6-7-15(18(16)28)19(29)32-4/h6-8,14,28H,5,9-13H2,1-4H3,(H,24,27)(H,25,31) |
| InChIKey | YRRSDUPSRUYVDN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|