C18H20N2O5 — CID 119218493
2-[2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]phenyl]acetic acid (PubChem CID 119218493) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]phenyl]acetic acid.
| Compound Name | 2-[2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 119218493 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1NC(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C18H20N2O5/c21-15(19-14-8-4-1-5-11(14)9-16(22)23)10-20-17(24)12-6-2-3-7-13(12)18(20)25/h1,4-5,8,12-13H,2-3,6-7,9-10H2,(H,19,21)(H,22,23) |
| InChIKey | HZTQGSTUDBBHQR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|