C16H16Cl2N2O3 — CID 51140712
N-(2,3-dichlorophenyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide (PubChem CID 51140712) has the molecular formula C16H16Cl2N2O3 and a molecular weight of 355.22 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 51140712 |
| Molecular Formula | C16H16Cl2N2O3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl2N2O3/c17-11-6-3-7-12(14(11)18)19-13(21)8-20-15(22)9-4-1-2-5-10(9)16(20)23/h3,6-7,9-10H,1-2,4-5,8H2,(H,19,21) |
| InChIKey | HRXQMALCOHYJNO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|